The ligands KS2CN(Bz)CH2CH2N(Bz)CS2K (K2L1), N(CH2CH2N(Me)CS2Na)3 (Na3L2), and the new chelates {(CH2CH2)NCS2Na}3 (Na3L3) and {CH2CH2N(CS2Na)CH2CH2CH2NCS2Na}2 (Na4L4), react with the gold(I) complexes [ClAu(PR3)] (R = Me, Ph, Cy) and [ClAu(IDip)] to yield di-, tri-and tetragold compounds. Larger metal units can also be coordinated by the longer, flexible linker, K2L1. Thus two equivalents of cis-[PtCl2(PEt3)2] react with K2L1 in the presence of NH4PF6 to yield the bimetallic complex [L1{Pt(PEt3)2}2](PF6)2. The compounds [NiCl2(dppp)] and [MCl2(dppf)] (M = Ni, Pd, Pt; dppp = 1,3-bis(diphenylphosphino)propane, dppf = 1,1'-bis(diphenylphosphino)ferrocene) also yield the dications, [L1{Ni(dppp)}2]2+ and [L1{Ni(dppf)}2]2+ in an analogous fashion. In the same manner, reaction between [(L′2)(AuCl)2] (L′2 = dppm, dppf; dppm = bis(diphenylphosphino)methane) and KS2CN(Bz)CH2CH2N(Bz)CS2K yield [L1{Au2(L′2)}2]. The molecular structures of [L1{M(dppf)}2](PF6)2 (M = Ni, Pd) and [L1{Au(PR3)}2] (R = Me, Ph) are reported.